C8H5BrF3NO3 — CID 130112405
6-(bromomethyl)-5-hydroxy-2-(trifluoromethoxy)pyridine-3-carbaldehyde (PubChem CID 130112405) has the molecular formula C8H5BrF3NO3 and a molecular weight of 300.03 g/mol. Its IUPAC name is 6-(bromomethyl)-5-hydroxy-2-(trifluoromethoxy)pyridine-3-carbaldehyde.
| Compound Name | 6-(bromomethyl)-5-hydroxy-2-(trifluoromethoxy)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 130112405 |
| Molecular Formula | C8H5BrF3NO3 |
| Molecular Weight | 300.03 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | 6-(bromomethyl)-5-hydroxy-2-(trifluoromethoxy)pyridine-3-carbaldehyde |
| SMILES | O=Cc1cc(O)c(CBr)nc1OC(F)(F)F |
| InChI | InChI=1S/C8H5BrF3NO3/c9-2-5-6(15)1-4(3-14)7(13-5)16-8(10,11)12/h1,3,15H,2H2 |
| InChIKey | MNUJJXRZNJDHDD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.03 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|