C10H13NO2 — CID 13011424
1-[(2E,4E)-hexa-2,4-dienoyl]pyrrolidin-2-one (PubChem CID 13011424) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-[(2E,4E)-hexa-2,4-dienoyl]pyrrolidin-2-one.
| Compound Name | 1-[(2E,4E)-hexa-2,4-dienoyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 13011424 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-[(2E,4E)-hexa-2,4-dienoyl]pyrrolidin-2-one |
| SMILES | C/C=C/C=C/C(=O)N1CCCC1=O |
| InChI | InChI=1S/C10H13NO2/c1-2-3-4-6-9(12)11-8-5-7-10(11)13/h2-4,6H,5,7-8H2,1H3/b3-2+,6-4+ |
| InChIKey | ZEDYIRPVXPRQJT-WJPDYIDTSA-N |
| XLogP | 1.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|