C9H12Br2N2 — CID 130114720
3,5-dibromo-2-(2-methylpropyl)pyridin-4-amine (PubChem CID 130114720) has the molecular formula C9H12Br2N2 and a molecular weight of 308.02 g/mol. Its IUPAC name is 3,5-dibromo-2-(2-methylpropyl)pyridin-4-amine.
| Compound Name | 3,5-dibromo-2-(2-methylpropyl)pyridin-4-amine |
|---|---|
| PubChem CID | 130114720 |
| Molecular Formula | C9H12Br2N2 |
| Molecular Weight | 308.02 g/mol |
| Exact Mass | 305.94 |
| IUPAC Name | 3,5-dibromo-2-(2-methylpropyl)pyridin-4-amine |
| SMILES | CC(C)Cc1ncc(Br)c(N)c1Br |
| InChI | InChI=1S/C9H12Br2N2/c1-5(2)3-7-8(11)9(12)6(10)4-13-7/h4-5H,3H2,1-2H3,(H2,12,13) |
| InChIKey | RQUCDBJTDPNUOW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.02 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |