C9H14N4O — CID 130118096
3-methoxy-6-piperidin-2-yl-1,2,4-triazine (PubChem CID 130118096) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 3-methoxy-6-piperidin-2-yl-1,2,4-triazine.
| Compound Name | 3-methoxy-6-piperidin-2-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 130118096 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 3-methoxy-6-piperidin-2-yl-1,2,4-triazine |
| SMILES | COc1ncc(C2CCCCN2)nn1 |
| InChI | InChI=1S/C9H14N4O/c1-14-9-11-6-8(12-13-9)7-4-2-3-5-10-7/h6-7,10H,2-5H2,1H3 |
| InChIKey | FRQKMCGODBJNCB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |