C8H12N4 — CID 130118092
6-piperidin-2-yl-1,2,4-triazine (PubChem CID 130118092) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 6-piperidin-2-yl-1,2,4-triazine.
| Compound Name | 6-piperidin-2-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 130118092 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 6-piperidin-2-yl-1,2,4-triazine |
| SMILES | c1ncc(C2CCCCN2)nn1 |
| InChI | InChI=1S/C8H12N4/c1-2-4-10-7(3-1)8-5-9-6-11-12-8/h5-7,10H,1-4H2 |
| InChIKey | FZCKQRABXDUZAH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |