About 2-pyridazin-4-ylazepane
2-pyridazin-4-ylazepane (PubChem CID 104670038) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-pyridazin-4-ylazepane.
Molecular Properties
| Compound Name | 2-pyridazin-4-ylazepane |
| PubChem CID | 104670038 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2-pyridazin-4-ylazepane |
| SMILES | c1cc(C2CCCCCN2)cnn1 |
| InChI | InChI=1S/C10H15N3/c1-2-4-10(11-6-3-1)9-5-7-12-13-8-9/h5,7-8,10-11H,1-4,6H2 |
| InChIKey | QSVNSKIGUDZJNG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyridazin-4-ylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridazin-4-ylazepane?
The IUPAC name of 2-pyridazin-4-ylazepane (CID 104670038) is 2-pyridazin-4-ylazepane.
What is the SMILES notation for 2-pyridazin-4-ylazepane?
The canonical SMILES for 2-pyridazin-4-ylazepane is c1cc(C2CCCCCN2)cnn1.
What is the InChIKey of 2-pyridazin-4-ylazepane?
The InChIKey is QSVNSKIGUDZJNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-2-4-10(11-6-3-1)9-5-7-12-13-8-9/h5,7-8,10-11H,1-4,6H2.
What are the key properties of 2-pyridazin-4-ylazepane?
2-pyridazin-4-ylazepane has a molecular weight of 177.25 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridazin-4-ylazepane is sourced from PubChem (CID 104670038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).