C19H14FN3OS2 — CID 1301232
(5S)-5-[(4-fluorophenyl)methyl]-3-phenyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (PubChem CID 1301232) has the molecular formula C19H14FN3OS2 and a molecular weight of 383.47 g/mol. Its IUPAC name is (5S)-5-[(4-fluorophenyl)methyl]-3-phenyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | (5S)-5-[(4-fluorophenyl)methyl]-3-phenyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1301232 |
| Molecular Formula | C19H14FN3OS2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (5S)-5-[(4-fluorophenyl)methyl]-3-phenyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| SMILES | O=C1[C@H](Cc2ccc(F)cc2)SC(=Nc2nccs2)N1c1ccccc1 |
| InChI | InChI=1S/C19H14FN3OS2/c20-14-8-6-13(7-9-14)12-16-17(24)23(15-4-2-1-3-5-15)19(26-16)22-18-21-10-11-25-18/h1-11,16H,12H2/t16-/m0/s1 |
| InChIKey | DWWSLGLNUKOQNA-INIZCTEOSA-N |
| XLogP | 4.66 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|