C19H11ClFN3OS2 — CID 18844577
(2E,5Z)-5-[(2-chloro-6-fluorophenyl)methylidene]-3-phenyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (PubChem CID 18844577) has the molecular formula C19H11ClFN3OS2 and a molecular weight of 415.90 g/mol. Its IUPAC name is (2E,5Z)-5-[(2-chloro-6-fluorophenyl)methylidene]-3-phenyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(2-chloro-6-fluorophenyl)methylidene]-3-phenyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18844577 |
| Molecular Formula | C19H11ClFN3OS2 |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | (2E,5Z)-5-[(2-chloro-6-fluorophenyl)methylidene]-3-phenyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2c(F)cccc2Cl)S/C(=N/c2nccs2)N1c1ccccc1 |
| InChI | InChI=1S/C19H11ClFN3OS2/c20-14-7-4-8-15(21)13(14)11-16-17(25)24(12-5-2-1-3-6-12)19(27-16)23-18-22-9-10-26-18/h1-11H/b16-11-,23-19+ |
| InChIKey | PZRFZQNRMVYBCZ-RFTHPBJJSA-N |
| XLogP | 5.74 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|