C8H12N2O — CID 130123800
4,5,6,7-tetrahydroindazol-1-ylmethanol (PubChem CID 130123800) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 4,5,6,7-tetrahydroindazol-1-ylmethanol.
| Compound Name | 4,5,6,7-tetrahydroindazol-1-ylmethanol |
|---|---|
| PubChem CID | 130123800 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 4,5,6,7-tetrahydroindazol-1-ylmethanol |
| SMILES | OCn1ncc2c1CCCC2 |
| InChI | InChI=1S/C8H12N2O/c11-6-10-8-4-2-1-3-7(8)5-9-10/h5,11H,1-4,6H2 |
| InChIKey | DIDSHQRSTPLPDW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |