C10H16O4 — CID 13012675
ethyl 2,6-dimethyl-4-oxooxane-3-carboxylate (PubChem CID 13012675) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is ethyl 2,6-dimethyl-4-oxooxane-3-carboxylate.
| Compound Name | ethyl 2,6-dimethyl-4-oxooxane-3-carboxylate |
|---|---|
| PubChem CID | 13012675 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | ethyl 2,6-dimethyl-4-oxooxane-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)CC(C)OC1C |
| InChI | InChI=1S/C10H16O4/c1-4-13-10(12)9-7(3)14-6(2)5-8(9)11/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | WYTODCGVFBAVNL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|