About 12-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one
12-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one (PubChem CID 130126824) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 12-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one.
Analyze 12-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one?
The IUPAC name of 12-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one (CID 130126824) is 12-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one.
What is the SMILES notation for 12-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one?
The canonical SMILES for 12-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one is O=C1CC2c3ccccc3C(C1)C2O.
What is the InChIKey of 12-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one?
The InChIKey is WTUJGDNXIGMCSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c13-7-5-10-8-3-1-2-4-9(8)11(6-7)12(10)14/h1-4,10-12,14H,5-6H2.
What are the key properties of 12-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one?
12-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one has a molecular weight of 188.23 g/mol, XLogP of 1.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one is sourced from PubChem (CID 130126824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).