C7H10N2O3 — CID 130130720
1-[(2R)-2,3-dihydroxypropyl]pyrimidin-2-one (PubChem CID 130130720) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 1-[(2R)-2,3-dihydroxypropyl]pyrimidin-2-one.
| Compound Name | 1-[(2R)-2,3-dihydroxypropyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 130130720 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 1-[(2R)-2,3-dihydroxypropyl]pyrimidin-2-one |
| SMILES | O=c1ncccn1C[C@@H](O)CO |
| InChI | InChI=1S/C7H10N2O3/c10-5-6(11)4-9-3-1-2-8-7(9)12/h1-3,6,10-11H,4-5H2/t6-/m1/s1 |
| InChIKey | LZLRIIMAUBGWJZ-ZCFIWIBFSA-N |
| XLogP | -1.40 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |