C10H17NO2 — CID 130136419
5-(hydroxymethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-isoquinolin-1-one (PubChem CID 130136419) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 5-(hydroxymethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-isoquinolin-1-one.
| Compound Name | 5-(hydroxymethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 130136419 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 5-(hydroxymethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-isoquinolin-1-one |
| SMILES | O=C1NCCC2C(CO)CCCC12 |
| InChI | InChI=1S/C10H17NO2/c12-6-7-2-1-3-9-8(7)4-5-11-10(9)13/h7-9,12H,1-6H2,(H,11,13) |
| InChIKey | WCNZJGAFELEEGM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |