C9H12O3 — CID 130149487
1-(5-methylfuran-3-yl)but-3-ene-1,2-diol (PubChem CID 130149487) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 1-(5-methylfuran-3-yl)but-3-ene-1,2-diol.
| Compound Name | 1-(5-methylfuran-3-yl)but-3-ene-1,2-diol |
|---|---|
| PubChem CID | 130149487 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 1-(5-methylfuran-3-yl)but-3-ene-1,2-diol |
| SMILES | C=CC(O)C(O)c1coc(C)c1 |
| InChI | InChI=1S/C9H12O3/c1-3-8(10)9(11)7-4-6(2)12-5-7/h3-5,8-11H,1H2,2H3 |
| InChIKey | XLGFCSWWJZCDIB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|