C14H16O4 — CID 57196583
1-(5-methylfuran-2-yl)-2-(5-prop-2-enylfuran-3-yl)ethane-1,2-diol (PubChem CID 57196583) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-(5-methylfuran-2-yl)-2-(5-prop-2-enylfuran-3-yl)ethane-1,2-diol.
| Compound Name | 1-(5-methylfuran-2-yl)-2-(5-prop-2-enylfuran-3-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 57196583 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-(5-methylfuran-2-yl)-2-(5-prop-2-enylfuran-3-yl)ethane-1,2-diol |
| SMILES | C=CCc1cc(C(O)C(O)c2ccc(C)o2)co1 |
| InChI | InChI=1S/C14H16O4/c1-3-4-11-7-10(8-17-11)13(15)14(16)12-6-5-9(2)18-12/h3,5-8,13-16H,1,4H2,2H3 |
| InChIKey | OEORQVSDHBNHJX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|