C9H15NO2 — CID 130152183
2-methylidene-3,5,6,7,8,8a-hexahydro-1H-indolizine-6,8-diol (PubChem CID 130152183) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 2-methylidene-3,5,6,7,8,8a-hexahydro-1H-indolizine-6,8-diol.
| Compound Name | 2-methylidene-3,5,6,7,8,8a-hexahydro-1H-indolizine-6,8-diol |
|---|---|
| PubChem CID | 130152183 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 2-methylidene-3,5,6,7,8,8a-hexahydro-1H-indolizine-6,8-diol |
| SMILES | C=C1CC2C(O)CC(O)CN2C1 |
| InChI | InChI=1S/C9H15NO2/c1-6-2-8-9(12)3-7(11)5-10(8)4-6/h7-9,11-12H,1-5H2 |
| InChIKey | HVPSWUMLRWLQOB-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|