C9H15NO — CID 5323918
(8R,8aR)-6-methylidene-2,3,5,7,8,8a-hexahydro-1H-indolizin-8-ol (PubChem CID 5323918) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (8R,8aR)-6-methylidene-2,3,5,7,8,8a-hexahydro-1H-indolizin-8-ol.
| Compound Name | (8R,8aR)-6-methylidene-2,3,5,7,8,8a-hexahydro-1H-indolizin-8-ol |
|---|---|
| PubChem CID | 5323918 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (8R,8aR)-6-methylidene-2,3,5,7,8,8a-hexahydro-1H-indolizin-8-ol |
| SMILES | C=C1C[C@@H](O)[C@H]2CCCN2C1 |
| InChI | InChI=1S/C9H15NO/c1-7-5-9(11)8-3-2-4-10(8)6-7/h8-9,11H,1-6H2/t8-,9-/m1/s1 |
| InChIKey | YSMPNDAYCFICHG-RKDXNWHRSA-N |
| XLogP | 0.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|