C11H19NO — CID 102063177
(7S,8S,8aR)-7-prop-1-en-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol (PubChem CID 102063177) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (7S,8S,8aR)-7-prop-1-en-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol.
| Compound Name | (7S,8S,8aR)-7-prop-1-en-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol |
|---|---|
| PubChem CID | 102063177 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (7S,8S,8aR)-7-prop-1-en-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol |
| SMILES | C=C(C)[C@@H]1CCN2CCC[C@@H]2[C@H]1O |
| InChI | InChI=1S/C11H19NO/c1-8(2)9-5-7-12-6-3-4-10(12)11(9)13/h9-11,13H,1,3-7H2,2H3/t9-,10+,11-/m0/s1 |
| InChIKey | SMYLAFFSRQDQMC-AXFHLTTASA-N |
| XLogP | 1.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|