C19H35NO2 — CID 5366187
(6Z)-6-(6-hydroxy-2,5-dimethyloctylidene)-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol (PubChem CID 5366187) has the molecular formula C19H35NO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is (6Z)-6-(6-hydroxy-2,5-dimethyloctylidene)-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol.
| Compound Name | (6Z)-6-(6-hydroxy-2,5-dimethyloctylidene)-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
|---|---|
| PubChem CID | 5366187 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | (6Z)-6-(6-hydroxy-2,5-dimethyloctylidene)-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
| SMILES | CCC(O)C(C)CCC(C)/C=C1\CN2CCCC2C(C)(O)C1 |
| InChI | InChI=1S/C19H35NO2/c1-5-17(21)15(3)9-8-14(2)11-16-12-19(4,22)18-7-6-10-20(18)13-16/h11,14-15,17-18,21-22H,5-10,12-13H2,1-4H3/b16-11- |
| InChIKey | JEYPKKDUOBDNHP-WJDWOHSUSA-N |
| XLogP | 3.36 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|