C9H14N2O — CID 130153201
3-amino-1-(4-methyl-2-pyridinyl)propan-1-ol (PubChem CID 130153201) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-amino-1-(4-methyl-2-pyridinyl)propan-1-ol.
| Compound Name | 3-amino-1-(4-methyl-2-pyridinyl)propan-1-ol |
|---|---|
| PubChem CID | 130153201 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 3-amino-1-(4-methyl-2-pyridinyl)propan-1-ol |
| SMILES | Cc1ccnc(C(O)CCN)c1 |
| InChI | InChI=1S/C9H14N2O/c1-7-3-5-11-8(6-7)9(12)2-4-10/h3,5-6,9,12H,2,4,10H2,1H3 |
| InChIKey | NXKVWYIJDNFJMT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |