C11H14F3NO2 — CID 55257533
1-(4-methyl-2-pyridinyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol (PubChem CID 55257533) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 1-(4-methyl-2-pyridinyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol.
| Compound Name | 1-(4-methyl-2-pyridinyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
|---|---|
| PubChem CID | 55257533 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-(4-methyl-2-pyridinyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
| SMILES | Cc1ccnc(C(O)CCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3NO2/c1-8-2-4-15-9(6-8)10(16)3-5-17-7-11(12,13)14/h2,4,6,10,16H,3,5,7H2,1H3 |
| InChIKey | GCRWVVSMWUWRIH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|