C16H23F3O2 — CID 103210081
1-(2,3,4,5,6-pentamethylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol (PubChem CID 103210081) has the molecular formula C16H23F3O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentamethylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol.
| Compound Name | 1-(2,3,4,5,6-pentamethylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
|---|---|
| PubChem CID | 103210081 |
| Molecular Formula | C16H23F3O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 1-(2,3,4,5,6-pentamethylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
| SMILES | Cc1c(C)c(C)c(C(O)CCOCC(F)(F)F)c(C)c1C |
| InChI | InChI=1S/C16H23F3O2/c1-9-10(2)12(4)15(13(5)11(9)3)14(20)6-7-21-8-16(17,18)19/h14,20H,6-8H2,1-5H3 |
| InChIKey | WBPUIPXNACJIFH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|