C6H5BrN2S — CID 130153456
2-[5-(bromomethyl)-1,3-thiazol-2-yl]acetonitrile (PubChem CID 130153456) has the molecular formula C6H5BrN2S and a molecular weight of 217.09 g/mol. Its IUPAC name is 2-[5-(bromomethyl)-1,3-thiazol-2-yl]acetonitrile.
| Compound Name | 2-[5-(bromomethyl)-1,3-thiazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 130153456 |
| Molecular Formula | C6H5BrN2S |
| Molecular Weight | 217.09 g/mol |
| Exact Mass | 215.94 |
| IUPAC Name | 2-[5-(bromomethyl)-1,3-thiazol-2-yl]acetonitrile |
| SMILES | N#CCc1ncc(CBr)s1 |
| InChI | InChI=1S/C6H5BrN2S/c7-3-5-4-9-6(10-5)1-2-8/h4H,1,3H2 |
| InChIKey | VOIBPYLULDDYTK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.09 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|