C8H13Cl3N2O — CID 130154873
1-(1-amino-2,2,2-trichloroethyl)azepan-2-one (PubChem CID 130154873) has the molecular formula C8H13Cl3N2O and a molecular weight of 259.56 g/mol. Its IUPAC name is 1-(1-amino-2,2,2-trichloroethyl)azepan-2-one.
| Compound Name | 1-(1-amino-2,2,2-trichloroethyl)azepan-2-one |
|---|---|
| PubChem CID | 130154873 |
| Molecular Formula | C8H13Cl3N2O |
| Molecular Weight | 259.56 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 1-(1-amino-2,2,2-trichloroethyl)azepan-2-one |
| SMILES | NC(N1CCCCCC1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H13Cl3N2O/c9-8(10,11)7(12)13-5-3-1-2-4-6(13)14/h7H,1-5,12H2 |
| InChIKey | HQMDOHHLSBMKEU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|