About bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one
bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one (PubChem CID 21230621) has the molecular formula C20H22Cl3N3O8
and a molecular weight of 538.77 g/mol. Its IUPAC name is bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one.
Molecular Properties
| Compound Name | bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one |
| PubChem CID | 21230621 |
| Molecular Formula | C20H22Cl3N3O8 |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one |
| SMILES | O=C1CCCCCN1C(O)C(Cl)(Cl)Cl.O=[N+]([O-])c1ccc(O)cc1.O=[N+]([O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C8H12Cl3NO2.2C6H5NO3/c9-8(10,11)7(14)12-5-3-1-2-4-6(12)13;2*8-6-3-1-5(2-4-6)7(9)10/h7,14H,1-5H2;2*1-4,8H |
| InChIKey | VWPIAGDROANOFA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 167.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one?
The IUPAC name of bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one (CID 21230621) is bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one.
What is the SMILES notation for bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one?
The canonical SMILES for bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one is O=C1CCCCCN1C(O)C(Cl)(Cl)Cl.O=[N+]([O-])c1ccc(O)cc1.O=[N+]([O-])c1ccc(O)cc1.
What is the InChIKey of bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one?
The InChIKey is VWPIAGDROANOFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12Cl3NO2.2C6H5NO3/c9-8(10,11)7(14)12-5-3-1-2-4-6(12)13;2*8-6-3-1-5(2-4-6)7(9)10/h7,14H,1-5H2;2*1-4,8H.
What are the key properties of bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one?
bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one has a molecular weight of 538.77 g/mol, XLogP of 4.68, 3 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-nitrophenol);1-(2,2,2-trichloro-1-hydroxyethyl)azepan-2-one is sourced from PubChem (CID 21230621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).