About 2-bromo-5-butylaniline
2-bromo-5-butylaniline (PubChem CID 130156190) has the molecular formula C10H14BrN
and a molecular weight of 228.13 g/mol. Its IUPAC name is 2-bromo-5-butylaniline.
Molecular Properties
| Compound Name | 2-bromo-5-butylaniline |
| PubChem CID | 130156190 |
| Molecular Formula | C10H14BrN |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 2-bromo-5-butylaniline |
| SMILES | CCCCc1ccc(Br)c(N)c1 |
| InChI | InChI=1S/C10H14BrN/c1-2-3-4-8-5-6-9(11)10(12)7-8/h5-7H,2-4,12H2,1H3 |
| InChIKey | XFLAMHIKEKCNFI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-butylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-butylaniline?
The IUPAC name of 2-bromo-5-butylaniline (CID 130156190) is 2-bromo-5-butylaniline.
What is the SMILES notation for 2-bromo-5-butylaniline?
The canonical SMILES for 2-bromo-5-butylaniline is CCCCc1ccc(Br)c(N)c1.
What is the InChIKey of 2-bromo-5-butylaniline?
The InChIKey is XFLAMHIKEKCNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrN/c1-2-3-4-8-5-6-9(11)10(12)7-8/h5-7H,2-4,12H2,1H3.
What are the key properties of 2-bromo-5-butylaniline?
2-bromo-5-butylaniline has a molecular weight of 228.13 g/mol, XLogP of 3.37, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-butylaniline is sourced from PubChem (CID 130156190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).