C5H11N5O — CID 130161885
2-[methyl(2H-tetrazol-5-ylmethyl)amino]ethanol (PubChem CID 130161885) has the molecular formula C5H11N5O and a molecular weight of 157.18 g/mol. Its IUPAC name is 2-[methyl(2H-tetrazol-5-ylmethyl)amino]ethanol.
| Compound Name | 2-[methyl(2H-tetrazol-5-ylmethyl)amino]ethanol |
|---|---|
| PubChem CID | 130161885 |
| Molecular Formula | C5H11N5O |
| Molecular Weight | 157.18 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | 2-[methyl(2H-tetrazol-5-ylmethyl)amino]ethanol |
| SMILES | CN(CCO)Cc1nn[nH]n1 |
| InChI | InChI=1S/C5H11N5O/c1-10(2-3-11)4-5-6-8-9-7-5/h11H,2-4H2,1H3,(H,6,7,8,9) |
| InChIKey | LAKSPBLGSKXSDO-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.18 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |