C4H9N7O — CID 118248182
1-amino-1-methyl-3-(2H-tetrazol-5-ylmethyl)urea (PubChem CID 118248182) has the molecular formula C4H9N7O and a molecular weight of 171.16 g/mol. Its IUPAC name is 1-amino-1-methyl-3-(2H-tetrazol-5-ylmethyl)urea.
| Compound Name | 1-amino-1-methyl-3-(2H-tetrazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 118248182 |
| Molecular Formula | C4H9N7O |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 1-amino-1-methyl-3-(2H-tetrazol-5-ylmethyl)urea |
| SMILES | CN(N)C(=O)NCc1nn[nH]n1 |
| InChI | InChI=1S/C4H9N7O/c1-11(5)4(12)6-2-3-7-9-10-8-3/h2,5H2,1H3,(H,6,12)(H,7,8,9,10) |
| InChIKey | XYQVMFFQOFSFTH-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|