C5H11N7O — CID 118248215
1-amino-1-ethyl-3-(2H-tetrazol-5-ylmethyl)urea (PubChem CID 118248215) has the molecular formula C5H11N7O and a molecular weight of 185.19 g/mol. Its IUPAC name is 1-amino-1-ethyl-3-(2H-tetrazol-5-ylmethyl)urea.
| Compound Name | 1-amino-1-ethyl-3-(2H-tetrazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 118248215 |
| Molecular Formula | C5H11N7O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1-amino-1-ethyl-3-(2H-tetrazol-5-ylmethyl)urea |
| SMILES | CCN(N)C(=O)NCc1nn[nH]n1 |
| InChI | InChI=1S/C5H11N7O/c1-2-12(6)5(13)7-3-4-8-10-11-9-4/h2-3,6H2,1H3,(H,7,13)(H,8,9,10,11) |
| InChIKey | RVSCOMADALDMSQ-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|