C8H15N7O2 — CID 113270816
2-(N'-hydroxycarbamimidoyl)-2-methyl-N-(2H-tetrazol-5-ylmethyl)butanamide (PubChem CID 113270816) has the molecular formula C8H15N7O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-(N'-hydroxycarbamimidoyl)-2-methyl-N-(2H-tetrazol-5-ylmethyl)butanamide.
| Compound Name | 2-(N'-hydroxycarbamimidoyl)-2-methyl-N-(2H-tetrazol-5-ylmethyl)butanamide |
|---|---|
| PubChem CID | 113270816 |
| Molecular Formula | C8H15N7O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-(N'-hydroxycarbamimidoyl)-2-methyl-N-(2H-tetrazol-5-ylmethyl)butanamide |
| SMILES | CCC(C)(C(=O)NCc1nn[nH]n1)C(N)=NO |
| InChI | InChI=1S/C8H15N7O2/c1-3-8(2,6(9)13-17)7(16)10-4-5-11-14-15-12-5/h17H,3-4H2,1-2H3,(H2,9,13)(H,10,16)(H,11,12,14,15) |
| InChIKey | ZLPLPINHVFUGQM-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|