C11H20N6O2 — CID 114293041
2-(N'-hydroxycarbamimidoyl)-2-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]butanamide (PubChem CID 114293041) has the molecular formula C11H20N6O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-(N'-hydroxycarbamimidoyl)-2-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]butanamide.
| Compound Name | 2-(N'-hydroxycarbamimidoyl)-2-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]butanamide |
|---|---|
| PubChem CID | 114293041 |
| Molecular Formula | C11H20N6O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-(N'-hydroxycarbamimidoyl)-2-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]butanamide |
| SMILES | CCC(C)(C(=O)NCCCc1ncn[nH]1)C(N)=NO |
| InChI | InChI=1S/C11H20N6O2/c1-3-11(2,9(12)17-19)10(18)13-6-4-5-8-14-7-15-16-8/h7,19H,3-6H2,1-2H3,(H2,12,17)(H,13,18)(H,14,15,16) |
| InChIKey | YTKLJKGAPVQKHK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|