C9H13N5O — CID 114291581
2-cyano-2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide (PubChem CID 114291581) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is 2-cyano-2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide.
| Compound Name | 2-cyano-2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide |
|---|---|
| PubChem CID | 114291581 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-cyano-2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide |
| SMILES | CCC(C)(C#N)C(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C9H13N5O/c1-3-9(2,5-10)8(15)11-4-7-12-6-13-14-7/h6H,3-4H2,1-2H3,(H,11,15)(H,12,13,14) |
| InChIKey | WNPHBJHOSJDUID-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |