C8H16N6O — CID 114290570
2-(aminomethyl)-2-methyl-N-(2H-tetrazol-5-ylmethyl)butanamide (PubChem CID 114290570) has the molecular formula C8H16N6O and a molecular weight of 212.26 g/mol. Its IUPAC name is 2-(aminomethyl)-2-methyl-N-(2H-tetrazol-5-ylmethyl)butanamide.
| Compound Name | 2-(aminomethyl)-2-methyl-N-(2H-tetrazol-5-ylmethyl)butanamide |
|---|---|
| PubChem CID | 114290570 |
| Molecular Formula | C8H16N6O |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-(aminomethyl)-2-methyl-N-(2H-tetrazol-5-ylmethyl)butanamide |
| SMILES | CCC(C)(CN)C(=O)NCc1nn[nH]n1 |
| InChI | InChI=1S/C8H16N6O/c1-3-8(2,5-9)7(15)10-4-6-11-13-14-12-6/h3-5,9H2,1-2H3,(H,10,15)(H,11,12,13,14) |
| InChIKey | WKAJRAIOABHKKZ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |