C7H14N6OS — CID 104908299
(2R)-2-amino-4-methylsulfanyl-N-(2H-tetrazol-5-ylmethyl)butanamide (PubChem CID 104908299) has the molecular formula C7H14N6OS and a molecular weight of 230.30 g/mol. Its IUPAC name is (2R)-2-amino-4-methylsulfanyl-N-(2H-tetrazol-5-ylmethyl)butanamide.
| Compound Name | (2R)-2-amino-4-methylsulfanyl-N-(2H-tetrazol-5-ylmethyl)butanamide |
|---|---|
| PubChem CID | 104908299 |
| Molecular Formula | C7H14N6OS |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (2R)-2-amino-4-methylsulfanyl-N-(2H-tetrazol-5-ylmethyl)butanamide |
| SMILES | CSCC[C@@H](N)C(=O)NCc1nn[nH]n1 |
| InChI | InChI=1S/C7H14N6OS/c1-15-3-2-5(8)7(14)9-4-6-10-12-13-11-6/h5H,2-4,8H2,1H3,(H,9,14)(H,10,11,12,13)/t5-/m1/s1 |
| InChIKey | JCCISCQCTWESQV-RXMQYKEDSA-N |
| XLogP | -1.10 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |