C13H20N4O3 — CID 114292962
2-[(Z)-N'-hydroxycarbamimidoyl]-N-[(6-methoxy-3-pyridinyl)methyl]-2-methylbutanamide (PubChem CID 114292962) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-[(Z)-N'-hydroxycarbamimidoyl]-N-[(6-methoxy-3-pyridinyl)methyl]-2-methylbutanamide.
| Compound Name | 2-[(Z)-N'-hydroxycarbamimidoyl]-N-[(6-methoxy-3-pyridinyl)methyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 114292962 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2-[(Z)-N'-hydroxycarbamimidoyl]-N-[(6-methoxy-3-pyridinyl)methyl]-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)NCc1ccc(OC)nc1)/C(N)=N/O |
| InChI | InChI=1S/C13H20N4O3/c1-4-13(2,11(14)17-19)12(18)16-8-9-5-6-10(20-3)15-7-9/h5-7,19H,4,8H2,1-3H3,(H2,14,17)(H,16,18) |
| InChIKey | WATNMDOLKDLROK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|