C10H21NOS — CID 130162029
(2R)-1-(2,2-dimethylthiomorpholin-4-yl)butan-2-ol (PubChem CID 130162029) has the molecular formula C10H21NOS and a molecular weight of 203.35 g/mol. Its IUPAC name is (2R)-1-(2,2-dimethylthiomorpholin-4-yl)butan-2-ol.
| Compound Name | (2R)-1-(2,2-dimethylthiomorpholin-4-yl)butan-2-ol |
|---|---|
| PubChem CID | 130162029 |
| Molecular Formula | C10H21NOS |
| Molecular Weight | 203.35 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (2R)-1-(2,2-dimethylthiomorpholin-4-yl)butan-2-ol |
| SMILES | CC[C@@H](O)CN1CCSC(C)(C)C1 |
| InChI | InChI=1S/C10H21NOS/c1-4-9(12)7-11-5-6-13-10(2,3)8-11/h9,12H,4-8H2,1-3H3/t9-/m1/s1 |
| InChIKey | DUPGHMJFXSAIRK-SECBINFHSA-N |
| XLogP | 1.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |