C11H24N2O — CID 130572077
(2R)-1-(3,3,4-trimethylpiperazin-1-yl)butan-2-ol (PubChem CID 130572077) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is (2R)-1-(3,3,4-trimethylpiperazin-1-yl)butan-2-ol.
| Compound Name | (2R)-1-(3,3,4-trimethylpiperazin-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 130572077 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | (2R)-1-(3,3,4-trimethylpiperazin-1-yl)butan-2-ol |
| SMILES | CC[C@@H](O)CN1CCN(C)C(C)(C)C1 |
| InChI | InChI=1S/C11H24N2O/c1-5-10(14)8-13-7-6-12(4)11(2,3)9-13/h10,14H,5-9H2,1-4H3/t10-/m1/s1 |
| InChIKey | XTTBGEPYXRGVSB-SNVBAGLBSA-N |
| XLogP | 0.78 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |