C10H23N3O — CID 63608754
1-amino-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol (PubChem CID 63608754) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-amino-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol.
| Compound Name | 1-amino-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 63608754 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 1-amino-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol |
| SMILES | CN1CCN(CC(O)CN)CC1(C)C |
| InChI | InChI=1S/C10H23N3O/c1-10(2)8-13(5-4-12(10)3)7-9(14)6-11/h9,14H,4-8,11H2,1-3H3 |
| InChIKey | JBHMUIDEKAKRKM-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |