C7H5BrF4N2O — CID 130162713
5-bromo-3-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-one (PubChem CID 130162713) has the molecular formula C7H5BrF4N2O and a molecular weight of 289.03 g/mol. Its IUPAC name is 5-bromo-3-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-one.
| Compound Name | 5-bromo-3-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 130162713 |
| Molecular Formula | C7H5BrF4N2O |
| Molecular Weight | 289.03 g/mol |
| Exact Mass | 287.95 |
| IUPAC Name | 5-bromo-3-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-one |
| SMILES | O=c1c(Br)cncn1CC(F)(F)C(F)F |
| InChI | InChI=1S/C7H5BrF4N2O/c8-4-1-13-3-14(5(4)15)2-7(11,12)6(9)10/h1,3,6H,2H2 |
| InChIKey | TZBHCCPQOYNIAQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.03 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|