C11H11BrINO — CID 130162731
N-(4-bromo-3-iodophenyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 130162731) has the molecular formula C11H11BrINO and a molecular weight of 380.02 g/mol. Its IUPAC name is N-(4-bromo-3-iodophenyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | N-(4-bromo-3-iodophenyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 130162731 |
| Molecular Formula | C11H11BrINO |
| Molecular Weight | 380.02 g/mol |
| Exact Mass | 378.91 |
| IUPAC Name | N-(4-bromo-3-iodophenyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)Nc2ccc(Br)c(I)c2)CC1 |
| InChI | InChI=1S/C11H11BrINO/c1-11(4-5-11)10(15)14-7-2-3-8(12)9(13)6-7/h2-3,6H,4-5H2,1H3,(H,14,15) |
| InChIKey | XLXIKGYAYKBJLC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.02 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|