C14H17BrINO — CID 114259357
N-(4-bromo-3-iodophenyl)-2,2,3,3-tetramethylcyclopropane-1-carboxamide (PubChem CID 114259357) has the molecular formula C14H17BrINO and a molecular weight of 422.10 g/mol. Its IUPAC name is N-(4-bromo-3-iodophenyl)-2,2,3,3-tetramethylcyclopropane-1-carboxamide.
| Compound Name | N-(4-bromo-3-iodophenyl)-2,2,3,3-tetramethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 114259357 |
| Molecular Formula | C14H17BrINO |
| Molecular Weight | 422.10 g/mol |
| Exact Mass | 420.95 |
| IUPAC Name | N-(4-bromo-3-iodophenyl)-2,2,3,3-tetramethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)C(C(=O)Nc2ccc(Br)c(I)c2)C1(C)C |
| InChI | InChI=1S/C14H17BrINO/c1-13(2)11(14(13,3)4)12(18)17-8-5-6-9(15)10(16)7-8/h5-7,11H,1-4H3,(H,17,18) |
| InChIKey | GYLBCSMZXBKVSK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.10 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|