C14H19NO2 — CID 66476911
N-(4-hydroxyphenyl)-2,2,3,3-tetramethylcyclopropane-1-carboxamide (PubChem CID 66476911) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2,2,3,3-tetramethylcyclopropane-1-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-2,2,3,3-tetramethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 66476911 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-(4-hydroxyphenyl)-2,2,3,3-tetramethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)C(C(=O)Nc2ccc(O)cc2)C1(C)C |
| InChI | InChI=1S/C14H19NO2/c1-13(2)11(14(13,3)4)12(17)15-9-5-7-10(16)8-6-9/h5-8,11,16H,1-4H3,(H,15,17) |
| InChIKey | UZAHQGGVPRWJFM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|