C9H10N2O3 — CID 130167440
1-but-2-ynyl-5-methyl-1,3-diazinane-2,4,6-trione (PubChem CID 130167440) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 1-but-2-ynyl-5-methyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-but-2-ynyl-5-methyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 130167440 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 1-but-2-ynyl-5-methyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC#CCN1C(=O)NC(=O)C(C)C1=O |
| InChI | InChI=1S/C9H10N2O3/c1-3-4-5-11-8(13)6(2)7(12)10-9(11)14/h6H,5H2,1-2H3,(H,10,12,14) |
| InChIKey | FCIZMUXAXUKUAJ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|