C9H5ClFNO2 — CID 130170904
3-(3-chloro-4-fluorophenyl)-2H-1,2-oxazol-5-one (PubChem CID 130170904) has the molecular formula C9H5ClFNO2 and a molecular weight of 213.59 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-2H-1,2-oxazol-5-one.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-2H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 130170904 |
| Molecular Formula | C9H5ClFNO2 |
| Molecular Weight | 213.59 g/mol |
| Exact Mass | 213.00 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-2H-1,2-oxazol-5-one |
| SMILES | O=c1cc(-c2ccc(F)c(Cl)c2)[nH]o1 |
| InChI | InChI=1S/C9H5ClFNO2/c10-6-3-5(1-2-7(6)11)8-4-9(13)14-12-8/h1-4,12H |
| InChIKey | IIBYJYOSLMUFAU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.59 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |