C7H12N4OS — CID 130171145
2-amino-3-methyl-N-(thiadiazol-5-yl)butanamide (PubChem CID 130171145) has the molecular formula C7H12N4OS and a molecular weight of 200.27 g/mol. Its IUPAC name is 2-amino-3-methyl-N-(thiadiazol-5-yl)butanamide.
| Compound Name | 2-amino-3-methyl-N-(thiadiazol-5-yl)butanamide |
|---|---|
| PubChem CID | 130171145 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-amino-3-methyl-N-(thiadiazol-5-yl)butanamide |
| SMILES | CC(C)C(N)C(=O)Nc1cnns1 |
| InChI | InChI=1S/C7H12N4OS/c1-4(2)6(8)7(12)10-5-3-9-11-13-5/h3-4,6H,8H2,1-2H3,(H,10,12) |
| InChIKey | BXIMAUIGRMHCBB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |