5-chloro-N-hydroxythiophene-2-carboximidoyl chloride

C5H3Cl2NOS — CID 130174133

IUPAC5-chloro-N-hydroxythiophene-2-carboximidoyl chloride
SMILESON=C(Cl)c1ccc(Cl)s1
InChIInChI=1S/C5H3Cl2NOS/c6-4-2-1-3(10-4)5(7)8-9/h1-2,9H
InChIKeyDZMCUSFIGSXQHI-UHFFFAOYSA-N
MW196.06 g/mol
LogP2.78
Rot. Bonds1

About 5-chloro-N-hydroxythiophene-2-carboximidoyl chloride

5-chloro-N-hydroxythiophene-2-carboximidoyl chloride (PubChem CID 130174133) has the molecular formula C5H3Cl2NOS and a molecular weight of 196.06 g/mol. Its IUPAC name is 5-chloro-N-hydroxythiophene-2-carboximidoyl chloride.

Molecular Properties

Compound Name5-chloro-N-hydroxythiophene-2-carboximidoyl chloride
PubChem CID130174133
Molecular FormulaC5H3Cl2NOS
Molecular Weight196.06 g/mol
Exact Mass194.93
IUPAC Name5-chloro-N-hydroxythiophene-2-carboximidoyl chloride
SMILESON=C(Cl)c1ccc(Cl)s1
InChIInChI=1S/C5H3Cl2NOS/c6-4-2-1-3(10-4)5(7)8-9/h1-2,9H
InChIKeyDZMCUSFIGSXQHI-UHFFFAOYSA-N
XLogP2.78
TPSA32.59 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.06
LogP ≤ 52.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 5-chloro-N-hydroxythiophene-2-carboximidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-N-hydroxythiophene-2-carboximidoyl chloride?
The IUPAC name of 5-chloro-N-hydroxythiophene-2-carboximidoyl chloride (CID 130174133) is 5-chloro-N-hydroxythiophene-2-carboximidoyl chloride.
What is the SMILES notation for 5-chloro-N-hydroxythiophene-2-carboximidoyl chloride?
The canonical SMILES for 5-chloro-N-hydroxythiophene-2-carboximidoyl chloride is ON=C(Cl)c1ccc(Cl)s1.
What is the InChIKey of 5-chloro-N-hydroxythiophene-2-carboximidoyl chloride?
The InChIKey is DZMCUSFIGSXQHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3Cl2NOS/c6-4-2-1-3(10-4)5(7)8-9/h1-2,9H.
What are the key properties of 5-chloro-N-hydroxythiophene-2-carboximidoyl chloride?
5-chloro-N-hydroxythiophene-2-carboximidoyl chloride has a molecular weight of 196.06 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-hydroxythiophene-2-carboximidoyl chloride is sourced from PubChem (CID 130174133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).