C20H24N2O3 — CID 130177234
methyl 2-[[cyclopentyl-(3-methyl-1H-indole-2-carbonyl)amino]methyl]prop-2-enoate (PubChem CID 130177234) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is methyl 2-[[cyclopentyl-(3-methyl-1H-indole-2-carbonyl)amino]methyl]prop-2-enoate.
| Compound Name | methyl 2-[[cyclopentyl-(3-methyl-1H-indole-2-carbonyl)amino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 130177234 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | methyl 2-[[cyclopentyl-(3-methyl-1H-indole-2-carbonyl)amino]methyl]prop-2-enoate |
| SMILES | C=C(CN(C(=O)c1[nH]c2ccccc2c1C)C1CCCC1)C(=O)OC |
| InChI | InChI=1S/C20H24N2O3/c1-13(20(24)25-3)12-22(15-8-4-5-9-15)19(23)18-14(2)16-10-6-7-11-17(16)21-18/h6-7,10-11,15,21H,1,4-5,8-9,12H2,2-3H3 |
| InChIKey | RDZYFUDNYYUUQB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|