C19H32O2 — CID 130177852
ethyl (2S,4aR)-6-ethyl-4a-methyl-5-propan-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-carboxylate (PubChem CID 130177852) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is ethyl (2S,4aR)-6-ethyl-4a-methyl-5-propan-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-carboxylate.
| Compound Name | ethyl (2S,4aR)-6-ethyl-4a-methyl-5-propan-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 130177852 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | ethyl (2S,4aR)-6-ethyl-4a-methyl-5-propan-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC[C@@]2(C)C(=CCC(CC)C2C(C)C)C1 |
| InChI | InChI=1S/C19H32O2/c1-6-14-8-9-16-12-15(18(20)21-7-2)10-11-19(16,5)17(14)13(3)4/h9,13-15,17H,6-8,10-12H2,1-5H3/t14?,15-,17?,19-/m0/s1 |
| InChIKey | MDTVPKSCWCETBG-ULGDZEHDSA-N |
| XLogP | 4.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|