C15H26O3 — CID 24823393
cis-ethyl (1S,3R)-4,4-dimethyl-3-[(2R)-4-oxobutan-2-yl]cyclohexane-1-carboxylate (PubChem CID 24823393) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is cis-ethyl (1S,3R)-4,4-dimethyl-3-[(2R)-4-oxobutan-2-yl]cyclohexane-1-carboxylate.
| Compound Name | cis-ethyl (1S,3R)-4,4-dimethyl-3-[(2R)-4-oxobutan-2-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 24823393 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | cis-ethyl (1S,3R)-4,4-dimethyl-3-[(2R)-4-oxobutan-2-yl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC(C)(C)[C@@H]([C@H](C)CC=O)C1 |
| InChI | InChI=1S/C15H26O3/c1-5-18-14(17)12-6-8-15(3,4)13(10-12)11(2)7-9-16/h9,11-13H,5-8,10H2,1-4H3/t11-,12+,13-/m1/s1 |
| InChIKey | LXVDYSRPPBAWBZ-FRRDWIJNSA-N |
| XLogP | 3.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|