C12H23NO2 — CID 165145297
ethyl (2R,4R)-2-(2-methylpropyl)piperidine-4-carboxylate (PubChem CID 165145297) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is ethyl (2R,4R)-2-(2-methylpropyl)piperidine-4-carboxylate.
| Compound Name | ethyl (2R,4R)-2-(2-methylpropyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 165145297 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | ethyl (2R,4R)-2-(2-methylpropyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCN[C@H](CC(C)C)C1 |
| InChI | InChI=1S/C12H23NO2/c1-4-15-12(14)10-5-6-13-11(8-10)7-9(2)3/h9-11,13H,4-8H2,1-3H3/t10-,11-/m1/s1 |
| InChIKey | RXGOWOXJCCISDV-GHMZBOCLSA-N |
| XLogP | 1.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |